| Name | 2-(4-nitrophenyl)ethanol |
| Synonyms | 4-nitrobenzeneethanol SS-P-NITROPHENYLETHANOL Benzeneethanol,4-nitro- 2-(4-nitrophenyl)ethanol 2-(p-nitrophenyl)ethanol 4-Nitrophenethyl alcohol p-nitrophenethyl alcohol p-Nitrophenylethyl alcohol 4-Nitrophenethyl alcohol,2-(4-Nitrophenyl)ethanol 4-Nitrophenethyl Alcohol2-(4-Nitrophenyl)ethyl Alcohol 2-(4-Nitrophenyl)ethan-1-ol, 4-(2-Hydroxyethyl)nitrobenzene |
| CAS | 100-27-6 |
| EINECS | 202-835-8 |
| InChI | InChI=1/C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,10H,5-6H2 |
| Molecular Formula | C8H9NO3 |
| Molar Mass | 167.16 |
| Density | 1.2917 (rough estimate) |
| Melting Point | 59-62°C(lit.) |
| Boling Point | 177°C16mm Hg(lit.) |
| Flash Point | 144.5°C |
| Solubility | Chloroform, Methanol (Slightly) |
| Vapor Presure | 0.000455mmHg at 25°C |
| Appearance | Solid |
| Color | White to Light Brown |
| BRN | 1866148 |
| pKa | 14.57±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Refractive Index | 1.5570 (estimate) |
| Use | For Organic synthesis |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes R40 - Limited evidence of a carcinogenic effect R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | SG8602000 |
| TSCA | Yes |
| HS Code | 29062990 |
| Hazard Note | Irritant |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for organic synthesis |